Malachite Green Carbinol base
Chemical Structure Depiction of
Malachite Green Carbinol base
Malachite Green Carbinol base
Compound characteristics
| Compound ID: | CE05-7469 |
| Compound Name: | Malachite Green Carbinol base |
| Molecular Weight: | 346.47 |
| Molecular Formula: | C23 H26 N2 O |
| CAS Number: | 510-13-4 |
| Smiles: | CN(C)c1ccc(cc1)C(c1ccccc1)(c1ccc(cc1)N(C)C)O |
| InChI Key: | LXHOGENDFZKPSF-UHFFFAOYSA-N |
| Short Description: | Malachite Green Carbinol Base (MGOH, MGCB), a non-fluorescent derivative of Malachite Green (MG), serves as a pH adjustment agent. Under UV light exposure, it releases OH- ions, causing a notable pH s hift. When subjected to a high-pressure UV lamp (500 W, 50 W/cm), MGCB transitions swiftly from colorless to deep green [1] [2]. |
| Stock amount: | 10 |