L-DABA hydrobromide
Chemical Structure Depiction of
L-DABA hydrobromide
L-DABA hydrobromide
Compound characteristics
| Compound ID: | CE05-8252 |
| Compound Name: | L-DABA hydrobromide |
| Molecular Weight: | 199.04 |
| Molecular Formula: | C4 H10 N2 O2.H Br |
| CAS Number: | 73143-97-2 |
| Smiles: | C(CN)[C@@H](C(O)=O)N.[Br] |
| InChI Key: | RVCHWEZQMFNGBK-DFWYDOINSA-N |
| Short Description: | L-DABA hydrobromide (L-2,4-Diaminobutyric acid hydrobromide) is a potent GABA transaminase inhibitor with antitumor and anticonvulsant activity for the study of neurological disorders. |
| Pathway: | Metabolism|||Others |
| Target: | Others|||Endogenous Metabolite |
| Alias: | L-2,4-Diaminobutyric acid hydrobromide |
| Stock amount: | 1041 |