Cromoglicic acid
Chemical Structure Depiction of
Cromoglicic acid
Cromoglicic acid
Compound characteristics
| Compound ID: | CE06-0283 |
| Compound Name: | Cromoglicic acid |
| Molecular Weight: | 468.37 |
| Molecular Formula: | C23 H16 O11 |
| CAS Number: | 16110-51-3 |
| Smiles: | C(C(COc1cccc2c1C(C=C(C(O)=O)O2)=O)O)Oc1cccc2c1C(C=C(C(O)=O)O2)=O |
| InChI Key: | IMZMKUWMOSJXDT-UHFFFAOYSA-N |
| Short Description: | Cromoglicic acid prevents the release of inflammatory chemicals such as histamine from mast cells. |
| Pathway: | Others |
| Target: | Others |
| Type of molecule: | Approved |
| Stock amount: | 849 |