AR 231453
Chemical Structure Depiction of
AR 231453
AR 231453
Compound characteristics
| Compound ID: | CE06-0977 |
| Compound Name: | AR 231453 |
| Molecular Weight: | 505.53 |
| Molecular Formula: | C21 H24 F N7 O5 S |
| CAS Number: | 733750-99-7 |
| Smiles: | CC(C)c1nc(C2CCN(CC2)c2c(c(Nc3ccc(cc3F)S(C)(=O)=O)ncn2)[N+]([O-])=O)on1 |
| InChI Key: | DGBKNTVAKIFYNU-UHFFFAOYSA-N |
| Short Description: | AR 231453 is a selective and orally available GPR119 agonist,can stimulate beta-cell replication and improve islet graft function. |
| Pathway: | GPCR/G Protein|||Endocrinology/Hormones |
| Target: | GPR |
| Stock amount: | 1486 |