Promethazine Sulfoxide
Chemical Structure Depiction of
Promethazine Sulfoxide
Promethazine Sulfoxide
Compound characteristics
| Compound ID: | CE06-1543 |
| Compound Name: | Promethazine Sulfoxide |
| Molecular Weight: | 300.42 |
| Molecular Formula: | C17 H20 N2 O S |
| CAS Number: | 7640-51-9 |
| Smiles: | CC(CN1c2ccccc2S(c2ccccc12)=O)N(C)C |
| InChI Key: | OWTCLFIFAFHQIX-ZDUSSCGKSA-N |
| Short Description: | Promethazine sulfoxide, a metabolite of the histamine H1 receptor antagonist promethazine, is produced via the action of the cytochrome P450 (CYP) isoform CYP2D6, converting promethazine into this com pound. |
| Stock amount: | 50 |