Tyrphostin AG 112
Chemical Structure Depiction of
Tyrphostin AG 112
Tyrphostin AG 112
Compound characteristics
| Compound ID: | CE06-1744 |
| Compound Name: | Tyrphostin AG 112 |
| Molecular Weight: | 236.23 |
| Molecular Formula: | C13 H8 N4 O |
| CAS Number: | 144978-82-5 |
| Smiles: | C(=C(C#N)/C(=C(C#N)C#N)N)\c1ccc(cc1)O |
| InChI Key: | DXVJRTIPBNBLLB-UHFFFAOYSA-N |
| Short Description: | Tyrphostin AG 112 is an inhibitor of EGFR phosphorylation. |
| Pathway: | Angiogenesis|||Tyrosine Kinase/Adaptors|||JAK/STAT signaling |
| Target: | EGFR |
| Stock amount: | 1994 |