Minaprine dihydrochloride
Chemical Structure Depiction of
Minaprine dihydrochloride
Minaprine dihydrochloride
Compound characteristics
| Compound ID: | CE06-2077 |
| Compound Name: | Minaprine dihydrochloride |
| Molecular Weight: | 371.31 |
| Molecular Formula: | C17 H22 N4 O.H Cl.H Cl |
| CAS Number: | 25953-17-7 |
| Smiles: | Cc1cc(c2ccccc2)nnc1NCCN1CCOCC1.[Cl].[Cl] |
| InChI Key: | GNUCGROXDZMCJI-UHFFFAOYSA-N |
| Short Description: | Minaprine dihydrochloride is a reversible MAO-A inhibitor; It weakly inhibit acetylcholinesterase. Minaprine dihydrochloride is an antidepressant for treatment of depression. |
| Pathway: | Metabolism|||Neuroscience |
| Target: | Monoamine Oxidase|||MAO |
| Type of molecule: | Approved |
| Stock amount: | 5264 |