Iptacopan hydrochloride
Chemical Structure Depiction of
Iptacopan hydrochloride
Iptacopan hydrochloride
Compound characteristics
| Compound ID: | CE06-2343 |
| Compound Name: | Iptacopan hydrochloride |
| Molecular Weight: | 458.98 |
| Molecular Formula: | C25 H30 N2 O4.H Cl |
| CAS Number: | 1646321-63-2 |
| Smiles: | [H][Cl].CCO[C@H]1CCN(Cc2c(cc(C)c3c2cc[nH]3)OC)[C@@H](C1)c1ccc(cc1)C(O)=O |
| InChI Key: | SEZXOFFLNHXEJE-GVWAYPJCSA-N |
| Short Description: | Iptacopan hydrochloride (LNP023 hydrochloride) is an orally bioavailable, highly potent and highly selective factor B inhibitor with an IC50 of 10 nM. Iptacopan hydrochloride shows direct, reversible, and high-affinity binding to human factor B with a KD of 7.9 nM. |
| Pathway: | Immunology/Inflammation |
| Target: | Complement System |
| Type of molecule: | Clinical |
| Alias: | Iptacopan HCl , LNP023 hydrochloride |
| Stock amount: | 10154 |