KM 91104
Chemical Structure Depiction of
KM 91104
KM 91104
Compound characteristics
| Compound ID: | CE06-2385 |
| Compound Name: | KM 91104 |
| Molecular Weight: | 272.26 |
| Molecular Formula: | C14 H12 N2 O4 |
| CAS Number: | 304481-60-5 |
| Smiles: | C(\c1ccccc1O)=N/NC(c1ccc(c(c1)O)O)=O |
| InChI Key: | GWVYHPUGEQGQSF-UHFFFAOYSA-N |
| Short Description: | KM 91104 is a cell permeable inhibitor of V-ATPase. KM91104 specifically targets the interaction between V-ATPase subunit A3 and subunit B2. |
| Pathway: | Membrane transporter/Ion channel |
| Target: | ATPase |
| Stock amount: | 1011 |