Xaliproden hydrochloride
Chemical Structure Depiction of
Xaliproden hydrochloride
Xaliproden hydrochloride
Compound characteristics
| Compound ID: | CE06-2421 |
| Compound Name: | Xaliproden hydrochloride |
| Molecular Weight: | 417.9 |
| Molecular Formula: | C24 H22 F3 N.H Cl |
| CAS Number: | 90494-79-4 |
| Smiles: | [H][Cl].C1CN(CCc2ccc3ccccc3c2)CC=C1c1cccc(c1)C(F)(F)F |
| InChI Key: | WVHBEIJGAINUBW-UHFFFAOYSA-N |
| Short Description: | Xaliproden is a compound that mimics the effects of nerve growth factor and is also a serotonin 5-HT1A receptor agonist. |
| Pathway: | GPCR/G Protein|||Neuroscience |
| Target: | Dopamine Receptor|||5-HT Receptor |
| Type of molecule: | Clinical |
| Stock amount: | 952 |