CHR-6494 TFA
Chemical Structure Depiction of
CHR-6494 TFA
CHR-6494 TFA
Compound characteristics
| Compound ID: | CE06-2617 |
| Compound Name: | CHR-6494 TFA |
| Molecular Weight: | 406.37 |
| Molecular Formula: | C16 H16 N6.C2 H F3 O2 |
| CAS Number: | 1458630-17-5 |
| Smiles: | CCCNc1ccc2ncc(c3ccc4c(c3)cn[nH]4)n2n1.C(C(F)(F)F)(O)=O |
| InChI Key: | ILWYDZNXJQESDI-UHFFFAOYSA-N |
| Short Description: | CHR-6494 TFA is a potent haspin inhibitor, with an IC50 of 2 nM. It inhibits histone H3T3 phosphorylation. CHR-6494 TFA induces the apoptosis of cancer cells, including melanoma and breast cancer. CHR -6494 TFA can be used in the research of cancer |
| Pathway: | Others |
| Target: | Others |
| Stock amount: | 1035 |