2-Methoxystypandrone
Chemical Structure Depiction of
2-Methoxystypandrone
2-Methoxystypandrone
Compound characteristics
| Compound ID: | CE06-4839 |
| Compound Name: | 2-Methoxystypandrone |
| Molecular Weight: | 260.24 |
| Molecular Formula: | C14 H12 O5 |
| CAS Number: | 85122-21-0 |
| Smiles: | CC(c1c(C)cc2C(C(=CC(c2c1O)=O)OC)=O)=O |
| InChI Key: | SSHJHOVVYKCJJI-UHFFFAOYSA-N |
| Short Description: | 2-Methoxystypandrone displays an immunomodulatory effect in a cellular model, it blocks inflammatory responses by impairing NF-IoB signaling to limit the inflammation and oxidative stress for preserva tion of BBB integrity. 2-Methoxystypandrone concomitantly promotes neurodevelopmental protein expression and endogenous neurogenesis through inactivation of GSK3beta to enhance beta-catenin signaling for upexpression of neuroprotective genes and proteins.2-Methoxystypandrone has anti-osteoclastogenic effect, could reflect the block of RANKL-induced association of TRAF6-TAK1 complexes with conseque nt decrease of IkappaB-mediated NF-kappaB and mitogen-activated protein kinases-mediated c-Fos activation pathways and suppression of NFATc1 and other gene expression, essential for bone resorption. |
| Pathway: | Angiogenesis|||Immunology/Inflammation|||NF-Kappab|||Stem Cells|||Chromatin/Epigenetic|||Neuroscience|||Apoptosis|||JAK/STAT signaling|||Cytoskeletal Signaling|||Proteases/Proteasome|||PI3K/Akt/mTOR s ignaling |
| Target: | Wnt/beta-catenin|||JAK|||NF-kappaB|||NOS|||GSK-3|||MMP|||BCL|||COX|||IkappaB/IKK|||TNF|||STAT |
| Stock amount: | 5 |