Bakkenolide B
Chemical Structure Depiction of
Bakkenolide B
Bakkenolide B
Compound characteristics
| Compound ID: | CE06-5460 |
| Compound Name: | Bakkenolide B |
| Molecular Weight: | 390.48 |
| Molecular Formula: | C22 H30 O6 |
| CAS Number: | 18455-98-6 |
| Smiles: | C/C=C(/C)C(=O)O[C@H]1CC[C@H](C)[C@@]2(C)C[C@@]3(C(=C)COC3=O)[C@@H]([C@@H]12)OC(C)=O |
| InChI Key: | AVAGQVZSHJYDED-PUQYOHHMSA-N |
| Short Description: | Bakkenolide B has suppressive properties for allergic and inflammatory responses and may be utilized as a potent agent for the treatment of asthma. |
| Pathway: | Immunology/Inflammation|||Neuroscience |
| Target: | NOS|||COX |
| Stock amount: | 5 |