Licorisoflavan A
Chemical Structure Depiction of
Licorisoflavan A
Licorisoflavan A
Compound characteristics
| Compound ID: | CE06-6302 |
| Compound Name: | Licorisoflavan A |
| Molecular Weight: | 438.56 |
| Molecular Formula: | C27 H34 O5 |
| CAS Number: | 129314-37-0 |
| Smiles: | CC(C)=CCc1c(ccc(c1O)[C@H]1Cc2c(cc(c(CC=C(C)C)c2OC)OC)OC1)O |
| InChI Key: | GDAAEAXMNLVRCZ-GOSISDBHSA-N |
| Short Description: | Licorisoflavan A shows weak scavenging activity against superoxide anion radical, it and licoricidin have potential for the development of novel host-modulating strategies for the treatment of cytokin e and/or MMP-mediated disorders such as periodontitis.Licorisoflavan A has bactericidal effects on S. mutans UA159 at the concentration of >=4 g/ml, it can be useful in developing oral hygiene product s, such as gargling solutions and dentifrices for preventing dental caries. |
| Pathway: | NF-Kappab|||DNA Damage/DNA Repair|||Cell Cycle/Checkpoint|||Proteases/Proteasome|||Immunology/Inflammation |
| Target: | IL Receptor|||MMP|||NF-kappaB|||DNA/RNA Synthesis |
| Stock amount: | 5 |