2-{[(4-hydroxyphenyl)imino]methyl}-4-nitrophenol
Chemical Structure Depiction of
2-{[(4-hydroxyphenyl)imino]methyl}-4-nitrophenol
2-{[(4-hydroxyphenyl)imino]methyl}-4-nitrophenol
Compound characteristics
| Compound ID: | 000L-1397 |
| Compound Name: | 2-{[(4-hydroxyphenyl)imino]methyl}-4-nitrophenol |
| Molecular Weight: | 258.23 |
| Molecular Formula: | C13 H10 N2 O4 |
| Smiles: | C(\c1cc(ccc1O)[N+]([O-])=O)=N/c1ccc(cc1)O |
| Stereo: | ACHIRAL |
| logP: | 2.5675 |
| logD: | 0.7161 |
| logSw: | -2.3071 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 75.912 |
| InChI Key: | DFRWJLZTGVUBMS-UHFFFAOYSA-N |