methyl 4-(3-methylbenzamido)benzoate
Chemical Structure Depiction of
methyl 4-(3-methylbenzamido)benzoate
methyl 4-(3-methylbenzamido)benzoate
Compound characteristics
| Compound ID: | 000L-1788 |
| Compound Name: | methyl 4-(3-methylbenzamido)benzoate |
| Molecular Weight: | 269.3 |
| Molecular Formula: | C16 H15 N O3 |
| Smiles: | Cc1cccc(c1)C(Nc1ccc(cc1)C(=O)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4827 |
| logD: | 3.4715 |
| logSw: | -3.6184 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.504 |
| InChI Key: | MCXZKFAMZKSGTM-UHFFFAOYSA-N |