4-(naphthalen-2-yl)-4-oxobutanoic acid
Chemical Structure Depiction of
4-(naphthalen-2-yl)-4-oxobutanoic acid
4-(naphthalen-2-yl)-4-oxobutanoic acid
Compound characteristics
| Compound ID: | 0069-0009 |
| Compound Name: | 4-(naphthalen-2-yl)-4-oxobutanoic acid |
| Molecular Weight: | 228.24 |
| Molecular Formula: | C14 H12 O3 |
| Smiles: | C(CC(c1ccc2ccccc2c1)=O)C(O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8126 |
| logD: | 0.0523 |
| logSw: | -3.605 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.598 |
| InChI Key: | GZKLCZIMSAHQDR-UHFFFAOYSA-N |