methyl 1-(2-hydroxyethyl)-2-methyl-1H-benzimidazole-5-carboxylate
Chemical Structure Depiction of
methyl 1-(2-hydroxyethyl)-2-methyl-1H-benzimidazole-5-carboxylate
methyl 1-(2-hydroxyethyl)-2-methyl-1H-benzimidazole-5-carboxylate
Compound characteristics
| Compound ID: | 0082-0010 |
| Compound Name: | methyl 1-(2-hydroxyethyl)-2-methyl-1H-benzimidazole-5-carboxylate |
| Molecular Weight: | 234.25 |
| Molecular Formula: | C12 H14 N2 O3 |
| Smiles: | Cc1nc2cc(ccc2n1CCO)C(=O)OC |
| Stereo: | ACHIRAL |
| logP: | 1.446 |
| logD: | 1.4408 |
| logSw: | -1.7837 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.023 |
| InChI Key: | KVOLIKDJFHDFHR-UHFFFAOYSA-N |