3-ethyl-5-[2-(3-ethyl-1,3-benzothiazol-2(3H)-ylidene)ethylidene]-2-sulfanylidene-1,3-thiazolidin-4-one
Chemical Structure Depiction of
3-ethyl-5-[2-(3-ethyl-1,3-benzothiazol-2(3H)-ylidene)ethylidene]-2-sulfanylidene-1,3-thiazolidin-4-one
3-ethyl-5-[2-(3-ethyl-1,3-benzothiazol-2(3H)-ylidene)ethylidene]-2-sulfanylidene-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 0082-0031 |
| Compound Name: | 3-ethyl-5-[2-(3-ethyl-1,3-benzothiazol-2(3H)-ylidene)ethylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Weight: | 348.51 |
| Molecular Formula: | C16 H16 N2 O S3 |
| Smiles: | CCN1C(\C(=C\C=C2/N(CC)c3ccccc3S2)SC1=S)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1315 |
| logD: | 4.1315 |
| logSw: | -4.1175 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 17.8478 |
| InChI Key: | KJXKJGBRCAUHMN-UHFFFAOYSA-N |