4,4'-(hydrazinediylidenedimethanylylidene)diphenol
Chemical Structure Depiction of
4,4'-(hydrazinediylidenedimethanylylidene)diphenol
4,4'-(hydrazinediylidenedimethanylylidene)diphenol
Compound characteristics
| Compound ID: | 0083-0053 |
| Compound Name: | 4,4'-(hydrazinediylidenedimethanylylidene)diphenol |
| Molecular Weight: | 240.26 |
| Molecular Formula: | C14 H12 N2 O2 |
| Smiles: | C(\c1ccc(cc1)O)=N/N=C/c1ccc(cc1)O |
| Stereo: | ACHIRAL |
| logP: | 1.5722 |
| logD: | 1.5708 |
| logSw: | -0.9893 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 54.908 |
| InChI Key: | UKWBKIBZVTUBQP-UHFFFAOYSA-N |