2,2'-(1,4-phenylene)bis(5-phenyl-1,3-oxazole)
Chemical Structure Depiction of
2,2'-(1,4-phenylene)bis(5-phenyl-1,3-oxazole)
2,2'-(1,4-phenylene)bis(5-phenyl-1,3-oxazole)
Compound characteristics
| Compound ID: | 0099-0136 |
| Compound Name: | 2,2'-(1,4-phenylene)bis(5-phenyl-1,3-oxazole) |
| Molecular Weight: | 364.4 |
| Molecular Formula: | C24 H16 N2 O2 |
| Smiles: | c1ccc(cc1)c1cnc(c2ccc(cc2)c2ncc(c3ccccc3)o2)o1 |
| Stereo: | ACHIRAL |
| logP: | 6.5318 |
| logD: | 6.5318 |
| logSw: | -6.3742 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 35.142 |
| InChI Key: | MASVCBBIUQRUKL-UHFFFAOYSA-N |