2-hydroxynaphthalene-1-carbaldehyde
Chemical Structure Depiction of
2-hydroxynaphthalene-1-carbaldehyde
2-hydroxynaphthalene-1-carbaldehyde
Compound characteristics
| Compound ID: | 0099-0204 |
| Compound Name: | 2-hydroxynaphthalene-1-carbaldehyde |
| Molecular Weight: | 172.18 |
| Molecular Formula: | C11 H8 O2 |
| Smiles: | [H]C(c1c(ccc2ccccc12)O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.356 |
| logD: | 2.3468 |
| logSw: | -2.6179 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 30.6742 |
| InChI Key: | NTCCNERMXRIPTR-UHFFFAOYSA-N |