2-(4-phenoxybenzoyl)benzoic acid
Chemical Structure Depiction of
2-(4-phenoxybenzoyl)benzoic acid
2-(4-phenoxybenzoyl)benzoic acid
Compound characteristics
| Compound ID: | 0108-0010 |
| Compound Name: | 2-(4-phenoxybenzoyl)benzoic acid |
| Molecular Weight: | 318.33 |
| Molecular Formula: | C20 H14 O4 |
| Smiles: | c1ccc(cc1)Oc1ccc(cc1)C(c1ccccc1C(O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.448 |
| logD: | -0.9883 |
| logSw: | -4.3577 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.861 |
| InChI Key: | DIGYASCXPKODLJ-UHFFFAOYSA-N |