4-amino-N-(2-aminophenyl)benzamide
Chemical Structure Depiction of
4-amino-N-(2-aminophenyl)benzamide
4-amino-N-(2-aminophenyl)benzamide
Compound characteristics
| Compound ID: | 0109-0007 |
| Compound Name: | 4-amino-N-(2-aminophenyl)benzamide |
| Molecular Weight: | 227.26 |
| Molecular Formula: | C13 H13 N3 O |
| Smiles: | c1ccc(c(c1)N)NC(c1ccc(cc1)N)=O |
| Stereo: | ACHIRAL |
| logP: | 1.0237 |
| logD: | 1.0168 |
| logSw: | -1.912 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 5 |
| Polar surface area: | 63.534 |
| InChI Key: | QGMGHALXLXKCBD-UHFFFAOYSA-N |