2,4-dinitro-1-[(prop-2-en-1-yl)oxy]benzene
Chemical Structure Depiction of
2,4-dinitro-1-[(prop-2-en-1-yl)oxy]benzene
2,4-dinitro-1-[(prop-2-en-1-yl)oxy]benzene
Compound characteristics
| Compound ID: | 0109-0237 |
| Compound Name: | 2,4-dinitro-1-[(prop-2-en-1-yl)oxy]benzene |
| Molecular Weight: | 224.17 |
| Molecular Formula: | C9 H8 N2 O5 |
| Smiles: | C=CCOc1ccc(cc1[N+]([O-])=O)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 2.49 |
| logD: | 2.49 |
| logSw: | -2.72 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 74.205 |
| InChI Key: | GSUJYIQTPFRZOY-UHFFFAOYSA-N |