N'-(4-methylbenzene-1-sulfonyl)adamantane-1-carbohydrazide
Chemical Structure Depiction of
N'-(4-methylbenzene-1-sulfonyl)adamantane-1-carbohydrazide
N'-(4-methylbenzene-1-sulfonyl)adamantane-1-carbohydrazide
Compound characteristics
| Compound ID: | 0111-0172 |
| Compound Name: | N'-(4-methylbenzene-1-sulfonyl)adamantane-1-carbohydrazide |
| Molecular Weight: | 348.46 |
| Molecular Formula: | C18 H24 N2 O3 S |
| Smiles: | Cc1ccc(cc1)S(NNC(C12CC3CC(CC(C3)C2)C1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7679 |
| logD: | 3.7672 |
| logSw: | -3.9717 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.742 |
| InChI Key: | JXZDVUGUPKIVTQ-UHFFFAOYSA-N |