2-hydroxy-1,2-bis(2-methoxyphenyl)ethan-1-one
Chemical Structure Depiction of
2-hydroxy-1,2-bis(2-methoxyphenyl)ethan-1-one
2-hydroxy-1,2-bis(2-methoxyphenyl)ethan-1-one
Compound characteristics
| Compound ID: | 0133-0084 |
| Compound Name: | 2-hydroxy-1,2-bis(2-methoxyphenyl)ethan-1-one |
| Molecular Weight: | 272.3 |
| Molecular Formula: | C16 H16 O4 |
| Smiles: | COc1ccccc1C(C(c1ccccc1OC)=O)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.5177 |
| logD: | 2.5177 |
| logSw: | -2.6772 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.651 |
| InChI Key: | CKZXADVHFFKWKQ-OAHLLOKOSA-N |