[1,1'-biphenyl]-4-yl 4-(5-propylpyridin-2-yl)benzoate
Chemical Structure Depiction of
[1,1'-biphenyl]-4-yl 4-(5-propylpyridin-2-yl)benzoate
[1,1'-biphenyl]-4-yl 4-(5-propylpyridin-2-yl)benzoate
Compound characteristics
| Compound ID: | 0154-0177 |
| Compound Name: | [1,1'-biphenyl]-4-yl 4-(5-propylpyridin-2-yl)benzoate |
| Molecular Weight: | 393.48 |
| Molecular Formula: | C27 H23 N O2 |
| Smiles: | CCCc1ccc(c2ccc(cc2)C(=O)Oc2ccc(cc2)c2ccccc2)nc1 |
| Stereo: | ACHIRAL |
| logP: | 7.1321 |
| logD: | 7.1291 |
| logSw: | -5.8495 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 29.2106 |
| InChI Key: | HYVUOYWOXOOCKI-UHFFFAOYSA-N |