1-(3-chloroadamantan-1-yl)methanamine--hydrogen chloride (1/1)
Chemical Structure Depiction of
1-(3-chloroadamantan-1-yl)methanamine--hydrogen chloride (1/1)
1-(3-chloroadamantan-1-yl)methanamine--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | 0162-0002 |
| Compound Name: | 1-(3-chloroadamantan-1-yl)methanamine--hydrogen chloride (1/1) |
| Molecular Weight: | 236.18 |
| Molecular Formula: | C11 H18 Cl N |
| Salt: | HCl |
| Smiles: | C1C2CC3(CC1CC(C2)(C3)[Cl])CN |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 2.1452 |
| logD: | 0.7136 |
| logSw: | -2.0672 |
| Hydrogen bond acceptors count: | 1 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 21.9321 |
| InChI Key: | QQGQLEXVVFHBGT-UHFFFAOYSA-N |