2-(5-methoxy-1H-indol-3-yl)ethan-1-amine
Chemical Structure Depiction of
2-(5-methoxy-1H-indol-3-yl)ethan-1-amine
2-(5-methoxy-1H-indol-3-yl)ethan-1-amine
Compound characteristics
| Compound ID: | 0167-0028 |
| Compound Name: | 2-(5-methoxy-1H-indol-3-yl)ethan-1-amine |
| Molecular Weight: | 190.24 |
| Molecular Formula: | C11 H14 N2 O |
| Smiles: | COc1ccc2c(c1)c(CCN)c[nH]2 |
| Stereo: | ACHIRAL |
| logP: | 1.2373 |
| logD: | -1.0426 |
| logSw: | -1.8386 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 38.808 |
| InChI Key: | JTEJPPKMYBDEMY-UHFFFAOYSA-N |