sodium--1-acetyl-2,3-dihydro-1H-indole-2-sulfonate (1/1)
Chemical Structure Depiction of
sodium--1-acetyl-2,3-dihydro-1H-indole-2-sulfonate (1/1)
sodium--1-acetyl-2,3-dihydro-1H-indole-2-sulfonate (1/1)
Compound characteristics
| Compound ID: | 0167-0064 |
| Compound Name: | sodium--1-acetyl-2,3-dihydro-1H-indole-2-sulfonate (1/1) |
| Molecular Weight: | 263.24 |
| Molecular Formula: | C10 H10 N O4 S |
| Salt: | Na+ |
| Smiles: | CC(N1C(Cc2ccccc12)S([O-])(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | -0.3732 |
| logD: | -0.3732 |
| logSw: | -1.8463 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 57.859 |
| InChI Key: | UOPWAVAYLGDGIB-JTQLQIEISA-M |