N-{3-chloro-4-[(5-chloroquinolin-8-yl)oxy]phenyl}benzamide
Chemical Structure Depiction of
N-{3-chloro-4-[(5-chloroquinolin-8-yl)oxy]phenyl}benzamide
N-{3-chloro-4-[(5-chloroquinolin-8-yl)oxy]phenyl}benzamide
Compound characteristics
| Compound ID: | 0180-0401 |
| Compound Name: | N-{3-chloro-4-[(5-chloroquinolin-8-yl)oxy]phenyl}benzamide |
| Molecular Weight: | 409.27 |
| Molecular Formula: | C22 H14 Cl2 N2 O2 |
| Smiles: | c1ccc(cc1)C(Nc1ccc(c(c1)[Cl])Oc1ccc(c2cccnc12)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.8991 |
| logD: | 5.8868 |
| logSw: | -6.2191 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.784 |
| InChI Key: | XNUGKNIEEUUYOX-UHFFFAOYSA-N |