1,3,8,8-tetramethyl-3-[3-(trimethylazaniumyl)propyl]-3-azabicyclo[3.2.1]octan-3-ium--iodide (1/2)
Chemical Structure Depiction of
1,3,8,8-tetramethyl-3-[3-(trimethylazaniumyl)propyl]-3-azabicyclo[3.2.1]octan-3-ium--iodide (1/2)
1,3,8,8-tetramethyl-3-[3-(trimethylazaniumyl)propyl]-3-azabicyclo[3.2.1]octan-3-ium--iodide (1/2)
Compound characteristics
| Compound ID: | 0180-0432 |
| Compound Name: | 1,3,8,8-tetramethyl-3-[3-(trimethylazaniumyl)propyl]-3-azabicyclo[3.2.1]octan-3-ium--iodide (1/2) |
| Molecular Weight: | 522.29 |
| Molecular Formula: | C17 H36 N2 |
| Salt: | 2I- |
| Smiles: | CC12CCC(C[N+](C)(CCC[N+](C)(C)C)C1)C2(C)C |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 2.9478 |
| logD: | 2.9478 |
| logSw: | -2.6776 |
| Polar surface area: | 0.6159 |
| InChI Key: | GPUGLFZXYGTLBI-UHFFFAOYSA-N |