3-[(4-methylanilino)methyl]-1,3-benzoxazol-2(3H)-one
Chemical Structure Depiction of
3-[(4-methylanilino)methyl]-1,3-benzoxazol-2(3H)-one
3-[(4-methylanilino)methyl]-1,3-benzoxazol-2(3H)-one
Compound characteristics
| Compound ID: | 0217-0050 |
| Compound Name: | 3-[(4-methylanilino)methyl]-1,3-benzoxazol-2(3H)-one |
| Molecular Weight: | 254.29 |
| Molecular Formula: | C15 H14 N2 O2 |
| Smiles: | Cc1ccc(cc1)NCN1C(=O)Oc2ccccc12 |
| Stereo: | ACHIRAL |
| logP: | 3.4818 |
| logD: | 3.4818 |
| logSw: | -3.833 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 34.227 |
| InChI Key: | MTSUMIHIRQJTPX-UHFFFAOYSA-N |