6-(4-nitrophenyl)benzimidazo[1,2-c]quinazoline
Chemical Structure Depiction of
6-(4-nitrophenyl)benzimidazo[1,2-c]quinazoline
6-(4-nitrophenyl)benzimidazo[1,2-c]quinazoline
Compound characteristics
| Compound ID: | 0242-0735 |
| Compound Name: | 6-(4-nitrophenyl)benzimidazo[1,2-c]quinazoline |
| Molecular Weight: | 340.34 |
| Molecular Formula: | C20 H12 N4 O2 |
| Smiles: | c1ccc2c(c1)c1nc3ccccc3n1c(c1ccc(cc1)[N+]([O-])=O)n2 |
| Stereo: | ACHIRAL |
| logP: | 5.2187 |
| logD: | 5.2136 |
| logSw: | -5.8666 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 49.618 |
| InChI Key: | UEPQELNFVZPLQP-UHFFFAOYSA-N |