cholest-5-en-3-yl 3-bromobutanoate
Chemical Structure Depiction of
cholest-5-en-3-yl 3-bromobutanoate
cholest-5-en-3-yl 3-bromobutanoate
Compound characteristics
| Compound ID: | 0242-0945 |
| Compound Name: | cholest-5-en-3-yl 3-bromobutanoate |
| Molecular Weight: | 535.65 |
| Molecular Formula: | C31 H51 Br O2 |
| Smiles: | CC(C)CCCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(CC(C)[Br])=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 8.47 |
| logD: | 8.47 |
| logSw: | -5.918 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 20.1266 |
| InChI Key: | YAHXNVGUCZQYAB-UHFFFAOYSA-N |