1,3-phenylene bis(2-fluorobenzoate)
Chemical Structure Depiction of
1,3-phenylene bis(2-fluorobenzoate)
1,3-phenylene bis(2-fluorobenzoate)
Compound characteristics
| Compound ID: | 0257-0039 |
| Compound Name: | 1,3-phenylene bis(2-fluorobenzoate) |
| Molecular Weight: | 354.31 |
| Molecular Formula: | C20 H12 F2 O4 |
| Smiles: | c1ccc(c(c1)C(=O)Oc1cccc(c1)OC(c1ccccc1F)=O)F |
| Stereo: | ACHIRAL |
| logP: | 4.5904 |
| logD: | 4.5904 |
| logSw: | -4.7056 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 40.994 |
| InChI Key: | XLVVJSPFNRFFNG-UHFFFAOYSA-N |