4-({3-[(4-carboxyphenyl)carbamoyl]benzene-1-sulfonyl}amino)benzoic acid
Chemical Structure Depiction of
4-({3-[(4-carboxyphenyl)carbamoyl]benzene-1-sulfonyl}amino)benzoic acid
4-({3-[(4-carboxyphenyl)carbamoyl]benzene-1-sulfonyl}amino)benzoic acid
Compound characteristics
| Compound ID: | 0261-0137 |
| Compound Name: | 4-({3-[(4-carboxyphenyl)carbamoyl]benzene-1-sulfonyl}amino)benzoic acid |
| Molecular Weight: | 440.43 |
| Molecular Formula: | C21 H16 N2 O7 S |
| Smiles: | c1cc(cc(c1)S(Nc1ccc(cc1)C(O)=O)(=O)=O)C(Nc1ccc(cc1)C(O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4781 |
| logD: | 1.0829 |
| logSw: | -3.8113 |
| Hydrogen bond acceptors count: | 12 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 120.796 |
| InChI Key: | LRLRDCCVFFSAKO-UHFFFAOYSA-N |