2-[(3-bromophenyl)methylidene]-1H-indene-1,3(2H)-dione
Chemical Structure Depiction of
2-[(3-bromophenyl)methylidene]-1H-indene-1,3(2H)-dione
2-[(3-bromophenyl)methylidene]-1H-indene-1,3(2H)-dione
Compound characteristics
| Compound ID: | 0290-0027 |
| Compound Name: | 2-[(3-bromophenyl)methylidene]-1H-indene-1,3(2H)-dione |
| Molecular Weight: | 313.15 |
| Molecular Formula: | C16 H9 Br O2 |
| Smiles: | C(=C1C(c2ccccc2C1=O)=O)c1cccc(c1)[Br] |
| Stereo: | ACHIRAL |
| logP: | 4.2118 |
| logD: | 4.2118 |
| logSw: | -4.5656 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 26.5463 |
| InChI Key: | SSWWUXCZVZHJMD-UHFFFAOYSA-N |