2,4-diphenylcyclobutane-1,3-dicarboxylic acid
Chemical Structure Depiction of
2,4-diphenylcyclobutane-1,3-dicarboxylic acid
2,4-diphenylcyclobutane-1,3-dicarboxylic acid
Compound characteristics
| Compound ID: | 0303-0007 |
| Compound Name: | 2,4-diphenylcyclobutane-1,3-dicarboxylic acid |
| Molecular Weight: | 296.32 |
| Molecular Formula: | C18 H16 O4 |
| Smiles: | c1ccc(cc1)C1C(C(C1C(O)=O)c1ccccc1)C(O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8387 |
| logD: | 0.076 |
| logSw: | -3.1402 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 57.035 |
| InChI Key: | QWFRRFLKWRIKSZ-UHFFFAOYSA-N |