methyl [(adamantan-1-yl)methyl]carbamate
Chemical Structure Depiction of
methyl [(adamantan-1-yl)methyl]carbamate
methyl [(adamantan-1-yl)methyl]carbamate
Compound characteristics
| Compound ID: | 0334-0123 |
| Compound Name: | methyl [(adamantan-1-yl)methyl]carbamate |
| Molecular Weight: | 223.31 |
| Molecular Formula: | C13 H21 N O2 |
| Smiles: | COC(NCC12CC3CC(CC(C3)C2)C1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1161 |
| logD: | 3.1161 |
| logSw: | -3.066 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.458 |
| InChI Key: | FXADKFCOMRXOSI-UHFFFAOYSA-N |