2,4-dichloro-N-(2-{2-[(4-nitrophenyl)methylidene]hydrazinyl}-2-oxoethyl)benzamide
Chemical Structure Depiction of
2,4-dichloro-N-(2-{2-[(4-nitrophenyl)methylidene]hydrazinyl}-2-oxoethyl)benzamide
2,4-dichloro-N-(2-{2-[(4-nitrophenyl)methylidene]hydrazinyl}-2-oxoethyl)benzamide
Compound characteristics
| Compound ID: | 0338-0066 |
| Compound Name: | 2,4-dichloro-N-(2-{2-[(4-nitrophenyl)methylidene]hydrazinyl}-2-oxoethyl)benzamide |
| Molecular Weight: | 395.2 |
| Molecular Formula: | C16 H12 Cl2 N4 O4 |
| Smiles: | C(C(N/N=C/c1ccc(cc1)[N+]([O-])=O)=O)NC(c1ccc(cc1[Cl])[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 3.8237 |
| logD: | 3.8236 |
| logSw: | -4.5743 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 93.407 |
| InChI Key: | BHVNKBPVPZSODM-UHFFFAOYSA-N |