3-(1H-indol-3-yl)-1-phenylprop-2-en-1-one
Chemical Structure Depiction of
3-(1H-indol-3-yl)-1-phenylprop-2-en-1-one
3-(1H-indol-3-yl)-1-phenylprop-2-en-1-one
Compound characteristics
| Compound ID: | 0350-0068 |
| Compound Name: | 3-(1H-indol-3-yl)-1-phenylprop-2-en-1-one |
| Molecular Weight: | 247.29 |
| Molecular Formula: | C17 H13 N O |
| Smiles: | C(=C/c1c[nH]c2ccccc12)\C(c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7343 |
| logD: | 3.7343 |
| logSw: | -4.2056 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 23.0846 |
| InChI Key: | XVTDCPBGCCPEBA-UHFFFAOYSA-N |