{2-[(2-bromoethyl)amino]-5-chlorophenyl}(phenyl)methanone
Chemical Structure Depiction of
{2-[(2-bromoethyl)amino]-5-chlorophenyl}(phenyl)methanone
{2-[(2-bromoethyl)amino]-5-chlorophenyl}(phenyl)methanone
Compound characteristics
| Compound ID: | 0354-0009 |
| Compound Name: | {2-[(2-bromoethyl)amino]-5-chlorophenyl}(phenyl)methanone |
| Molecular Weight: | 338.63 |
| Molecular Formula: | C15 H13 Br Cl N O |
| Smiles: | C(C[Br])Nc1ccc(cc1C(c1ccccc1)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.6245 |
| logD: | 4.6245 |
| logSw: | -4.7478 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 23.3552 |
| InChI Key: | KXJDJHUCMLXJLH-UHFFFAOYSA-N |