5-nitro-1,2-dihydroacenaphthylene
Chemical Structure Depiction of
5-nitro-1,2-dihydroacenaphthylene
5-nitro-1,2-dihydroacenaphthylene
Compound characteristics
| Compound ID: | 0358-0034 |
| Compound Name: | 5-nitro-1,2-dihydroacenaphthylene |
| Molecular Weight: | 199.21 |
| Molecular Formula: | C12 H9 N O2 |
| Smiles: | C1Cc2ccc(c3cccc1c23)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 4.017 |
| logD: | 4.017 |
| logSw: | -4.6737 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 33.334 |
| InChI Key: | CUARLQDWYSRQDF-UHFFFAOYSA-N |