2-nitro-4-(propan-2-yl)aniline--hydrogen chloride (1/1)
Chemical Structure Depiction of
2-nitro-4-(propan-2-yl)aniline--hydrogen chloride (1/1)
2-nitro-4-(propan-2-yl)aniline--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | 0375-0533 |
| Compound Name: | 2-nitro-4-(propan-2-yl)aniline--hydrogen chloride (1/1) |
| Molecular Weight: | 216.66 |
| Molecular Formula: | C9 H12 N2 O2 |
| Salt: | HCl |
| Smiles: | CC(C)c1ccc(c(c1)[N+]([O-])=O)N |
| Stereo: | ACHIRAL |
| logP: | 2.9064 |
| logD: | 2.9064 |
| logSw: | -3.4635 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 53.415 |
| InChI Key: | SBXKBHDWJBOCIG-UHFFFAOYSA-N |