(4-methoxyphenyl)(2-methylphenyl)methanone
Chemical Structure Depiction of
(4-methoxyphenyl)(2-methylphenyl)methanone
(4-methoxyphenyl)(2-methylphenyl)methanone
Compound characteristics
| Compound ID: | 0388-0139 |
| Compound Name: | (4-methoxyphenyl)(2-methylphenyl)methanone |
| Molecular Weight: | 226.27 |
| Molecular Formula: | C15 H14 O2 |
| Smiles: | Cc1ccccc1C(c1ccc(cc1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6069 |
| logD: | 3.6069 |
| logSw: | -3.7214 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 21.2492 |
| InChI Key: | VPAQGAOJFZBBTK-UHFFFAOYSA-N |