[3-(4-methylphenyl)adamantan-1-yl](piperidin-1-yl)methanone
Chemical Structure Depiction of
[3-(4-methylphenyl)adamantan-1-yl](piperidin-1-yl)methanone
[3-(4-methylphenyl)adamantan-1-yl](piperidin-1-yl)methanone
Compound characteristics
| Compound ID: | 0417-1643 |
| Compound Name: | [3-(4-methylphenyl)adamantan-1-yl](piperidin-1-yl)methanone |
| Molecular Weight: | 337.5 |
| Molecular Formula: | C23 H31 N O |
| Smiles: | Cc1ccc(cc1)C12CC3CC(CC(C3)(C2)C(N2CCCCC2)=O)C1 |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 6.0378 |
| logD: | 6.0378 |
| logSw: | -5.4193 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 16.6485 |
| InChI Key: | LAGFEPOYFSBVPA-UHFFFAOYSA-N |