1,1'-(difluoromethylene)bis(2,3,5,6-tetrafluoro-4-methylbenzene)
Chemical Structure Depiction of
1,1'-(difluoromethylene)bis(2,3,5,6-tetrafluoro-4-methylbenzene)
1,1'-(difluoromethylene)bis(2,3,5,6-tetrafluoro-4-methylbenzene)
Compound characteristics
| Compound ID: | 0438-0380 |
| Compound Name: | 1,1'-(difluoromethylene)bis(2,3,5,6-tetrafluoro-4-methylbenzene) |
| Molecular Weight: | 376.19 |
| Molecular Formula: | C15 H6 F10 |
| Smiles: | Cc1c(c(c(c(c1F)F)C(c1c(c(c(C)c(c1F)F)F)F)(F)F)F)F |
| Stereo: | ACHIRAL |
| logP: | 7.079 |
| logD: | 7.079 |
| logSw: | -6.1644 |
| InChI Key: | MZRVDDOBKRPLFU-UHFFFAOYSA-N |