2-({4-[(pyridin-4-yl)methyl]anilino}methyl)-1H-isoindole-1,3(2H)-dione
Chemical Structure Depiction of
2-({4-[(pyridin-4-yl)methyl]anilino}methyl)-1H-isoindole-1,3(2H)-dione
2-({4-[(pyridin-4-yl)methyl]anilino}methyl)-1H-isoindole-1,3(2H)-dione
Compound characteristics
| Compound ID: | 0466-0238 |
| Compound Name: | 2-({4-[(pyridin-4-yl)methyl]anilino}methyl)-1H-isoindole-1,3(2H)-dione |
| Molecular Weight: | 343.38 |
| Molecular Formula: | C21 H17 N3 O2 |
| Smiles: | C(c1ccc(cc1)NCN1C(c2ccccc2C1=O)=O)c1ccncc1 |
| Stereo: | ACHIRAL |
| logP: | 3.0563 |
| logD: | 3.0563 |
| logSw: | -3.3447 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.808 |
| InChI Key: | IBVMEDSZEJQUHN-UHFFFAOYSA-N |